2,4-Bis(1-Phenylethyl)Phenol

• CAS: 2769-94-0
• Catalog Number: ACM2769940
• Category: Main Products
• Molecular Weight: 302.40
• Molecular Formula: C22H22O
• Synonyms: Phenol, 2,4-bis(1-phenylethyl)-
• Appearance: Solid

Custom Q&A

What is the molecular formula of 2,4-Bis(1-Phenylethyl)Phenol?

The molecular formula is C22H22O.

What are the synonyms for 2,4-Bis(1-Phenylethyl)Phenol?

The synonyms for 2,4-Bis(1-Phenylethyl)Phenol are Phenol, 2,4-bis(1-phenylethyl)- and Phenol, bis(1-phenylethyl)-.

What is the molecular weight of 2,4-Bis(1-Phenylethyl)Phenol?

The molecular weight is 302.4 g/mol.

What is the IUPAC name of 2,4-Bis(1-Phenylethyl)Phenol?

The IUPAC name is 2,4-bis(1-phenylethyl)phenol.

What is the InChI identifier of 2,4-Bis(1-Phenylethyl)Phenol?

The InChI identifier is InChI=1S/C22H22O/c1-16(18-9-5-3-6-10-18)20-13-14-22(23)21(15-20)17(2)19-11-7-4-8-12-19/h3-17,23H,1-2H3.

What is the InChIKey of 2,4-Bis(1-Phenylethyl)Phenol?

The InChIKey is RCFAHSGZAAFQJH-UHFFFAOYSA-N.

What is the Canonical SMILES of 2,4-Bis(1-Phenylethyl)Phenol?

The Canonical SMILES is CC(C1=CC=CC=C1)C2=CC(=C(C=C2)O)C(C)C3=CC=CC=C3.

What is the CAS number of 2,4-Bis(1-Phenylethyl)Phenol?

The CAS number is 2769-94-0.

What is the XLogP3-AA value of 2,4-Bis(1-Phenylethyl)Phenol?

The XLogP3-AA value is 6.1.

Is 2,4-Bis(1-Phenylethyl)Phenol a semi-standard non-polar compound?

Yes, it is a semi-standard non-polar compound.