(2,3-Dimethylphenyl)methanol

• Catalog Number: ACMA00000496
• Category: Alcohols
• Molecular Weight: 136.19
• Molecular Formula: C₉H₁₀O₄
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (2,3-Dimethylphenyl)methanol?

The molecular formula is C9H12O.

What is the molecular weight of (2,3-Dimethylphenyl)methanol?

The molecular weight is 136.19 g/mol.

What is the IUPAC name of (2,3-Dimethylphenyl)methanol?

The IUPAC name is (2,3-dimethylphenyl)methanol.

What is the InChI of (2,3-Dimethylphenyl)methanol?

The InChI is InChI=1S/C9H12O/c1-7-4-3-5-9(6-10)8(7)2/h3-5,10H,6H2,1-2H3.

What is the InChIKey of (2,3-Dimethylphenyl)methanol?

The InChIKey is ZQQIVMXQYUZKIQ-UHFFFAOYSA-N.

What is the Canonical SMILES of (2,3-Dimethylphenyl)methanol?

The Canonical SMILES is CC1=C(C(=CC=C1)CO)C.

What is the CAS number of (2,3-Dimethylphenyl)methanol?

The CAS number is 13651-14-4.

What is the XLogP3-AA value of (2,3-Dimethylphenyl)methanol?

The XLogP3-AA value is 1.8.

How many hydrogen bond donor counts are there in (2,3-Dimethylphenyl)methanol?

There is 1 hydrogen bond donor count.

Is the compound canonicalized for (2,3-Dimethylphenyl)methanol?

Yes, the compound is canonicalized.