2,3-Dimethyl-4-hydroxymethylphenylboronic acid

• CAS: 1451391-38-0
• Catalog Number: ACM1451391380
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid?

The molecular formula of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid is C9H13BO3.

What are the synonyms for 2,3-Dimethyl-4-hydroxymethylphenylboronic acid?

The synonyms for 2,3-Dimethyl-4-hydroxymethylphenylboronic acid are:
1451391-38-0
(4-(Hydroxymethyl)-2,3-dimethylphenyl)boronic acid
[4-(hydroxymethyl)-2,3-dimethylphenyl]boronic acid
DTXSID501206672

What is the molecular weight of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid?

The molecular weight of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid is 180.01 g/mol.

What is the IUPAC name of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid?

The IUPAC name of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid is [4-(hydroxymethyl)-2,3-dimethylphenyl]boronic acid.

What is the InChI of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid?

The InChI of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid is InChI=1S/C9H13BO3/c1-6-7(2)9(10(12)13)4-3-8(6)5-11/h3-4,11-13H,5H2,1-2H3.

What is the InChIKey of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid?

The InChIKey of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid is NDYOOBLPKKGMTQ-UHFFFAOYSA-N.

What is the canonical SMILES of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid?

The canonical SMILES of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid is B(C1=C(C(=C(C=C1)CO)C)C)(O)O.

What is the hydrogen bond donor count of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid?

The hydrogen bond donor count of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid is 3.

What is the hydrogen bond acceptor count of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid?

The hydrogen bond acceptor count of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid is 3.

What is the rotatable bond count of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid?

The rotatable bond count of 2,3-Dimethyl-4-hydroxymethylphenylboronic acid is 2.