CAS
1072946-58-7 Purity
97%
1072946-58-7 Purity
97%
Inquiry Basket
2,3-Difluoropyridine-5-boronicacid
CAS
1366482-40-7
Catalog Number
ACM1366482407
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the chemical formula of 2,3-Difluoropyridine-5-boronic acid?
The chemical formula of 2,3-Difluoropyridine-5-boronic acid is C5H4BF2NO2.
What is the molecular weight of 2,3-Difluoropyridine-5-boronic acid?
The molecular weight of 2,3-Difluoropyridine-5-boronic acid is 158.90 g/mol.
What is the IUPAC name of 2,3-Difluoropyridine-5-boronic acid?
The IUPAC name of 2,3-Difluoropyridine-5-boronic acid is (5,6-difluoropyridin-3-yl)boronic acid.
What is the InChI of 2,3-Difluoropyridine-5-boronic acid?
The InChI of 2,3-Difluoropyridine-5-boronic acid is InChI=1S/C5H4BF2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2,10-11H.
What is the InChIKey of 2,3-Difluoropyridine-5-boronic acid?
The InChIKey of 2,3-Difluoropyridine-5-boronic acid is DMQCLRPLFKDGQN-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Difluoropyridine-5-boronic acid?
The canonical SMILES of 2,3-Difluoropyridine-5-boronic acid is B(C1=CC(=C(N=C1)F)F)(O)O.
What is the CAS number of 2,3-Difluoropyridine-5-boronic acid?
The CAS number of 2,3-Difluoropyridine-5-boronic acid is 1366482-40-7.
How many hydrogen bond donor counts does 2,3-Difluoropyridine-5-boronic acid have?
2,3-Difluoropyridine-5-boronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,3-Difluoropyridine-5-boronic acid have?
2,3-Difluoropyridine-5-boronic acid has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does 2,3-Difluoropyridine-5-boronic acid have?
2,3-Difluoropyridine-5-boronic acid has 1 rotatable bond count.
Recommended Products
