CAS
62306-79-0 Purity
96%
62306-79-0 Purity
96%
Inquiry Basket
2,3-Dichloro-6-fluorophenylboronic acid
CAS
1451393-17-1
Catalog Number
ACM1451393171
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2,3-dichloro-6-fluorophenyl)boronic acid.
What is the InChI representation of the compound?
The InChI representation of the compound is InChI=1S/C6H4BCl2FO2/c8-3-1-2-4(10)5(6(3)9)7(11)12/h1-2,11-12H.
What is the InChIKey of the compound?
The InChIKey of the compound is FUQOMAFSEYMNIS-UHFFFAOYSA-N.
What is the molecular formula of the compound?
The molecular formula of the compound is C6H4BCl2FO2.
What is the molecular weight of the compound?
The molecular weight of the compound is 208.81 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 1 rotatable bond count.
What is the exact mass of the compound?
The exact mass of the compound is 207.9665431 g/mol.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
