CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2,3-Diaminobenzotrifluoride
Catalog Number
ACMA00001854
Category
Aryl Fluorinated Building Blocks
Molecular Weight
176.14
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H314
RIDADR
NONH for all modes of transport
Symbol
GHS05
What is the molecular formula of 2,3-Diaminobenzotrifluoride?
The molecular formula of 2,3-Diaminobenzotrifluoride is C7H7F3N2.
What is the molecular weight of 2,3-Diaminobenzotrifluoride?
The molecular weight of 2,3-Diaminobenzotrifluoride is 176.14 g/mol.
What is the IUPAC name of 2,3-Diaminobenzotrifluoride?
The IUPAC name of 2,3-Diaminobenzotrifluoride is 3-(trifluoromethyl)benzene-1,2-diamine.
What is the InChI of 2,3-Diaminobenzotrifluoride?
The InChI of 2,3-Diaminobenzotrifluoride is InChI=1S/C7H7F3N2/c8-7(9,10)4-2-1-3-5(11)6(4)12/h1-3H,11-12H2.
What is the Canonical SMILES of 2,3-Diaminobenzotrifluoride?
The Canonical SMILES of 2,3-Diaminobenzotrifluoride is C1=CC(=C(C(=C1)N)N)C(F)(F)F.
What is the CAS number of 2,3-Diaminobenzotrifluoride?
The CAS number of 2,3-Diaminobenzotrifluoride is 360-60-1.
How many hydrogen bond donors are there in 2,3-Diaminobenzotrifluoride?
There are 2 hydrogen bond donors in 2,3-Diaminobenzotrifluoride.
How many hydrogen bond acceptors are there in 2,3-Diaminobenzotrifluoride?
There are 5 hydrogen bond acceptors in 2,3-Diaminobenzotrifluoride.
What is the topological polar surface area of 2,3-Diaminobenzotrifluoride?
The topological polar surface area of 2,3-Diaminobenzotrifluoride is 52 Ų.
Is the compound canonicalized in 2,3-Diaminobenzotrifluoride?
Yes, the compound is canonicalized in 2,3-Diaminobenzotrifluoride.
Recommended Products
