2,3,6-Trifluorobenzoic acid

• CAS: 2358-29-4
• Catalog Number: ACM2358294
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 176.09
• Molecular Formula: C₇H₃F₃O₂
• Hazard Statements: H315-H319-H335
• RIDADR: UN 3335
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2,3,6-Trifluorobenzoic acid?

The molecular formula is C7H3F3O2.

What is the molecular weight of 2,3,6-Trifluorobenzoic acid?

The molecular weight is 176.09 g/mol.

What is the IUPAC name of 2,3,6-Trifluorobenzoic acid?

The IUPAC name is 2,3,6-trifluorobenzoic acid.

What is the InChI of 2,3,6-Trifluorobenzoic acid?

The InChI is InChI=1S/C7H3F3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H,11,12).

How many hydrogen bond donor counts are there in 2,3,6-Trifluorobenzoic acid?

There is 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts are there in 2,3,6-Trifluorobenzoic acid?

There are 5 hydrogen bond acceptor counts.

What is the exact mass of 2,3,6-Trifluorobenzoic acid?

The exact mass is 176.00851382 g/mol.

How many rotatable bond counts are there in 2,3,6-Trifluorobenzoic acid?

There is 1 rotatable bond count.

Is the compound canonicalized?

Yes, the compound is canonicalized.

What is the topological polar surface area of 2,3,6-Trifluorobenzoic acid?

The topological polar surface area is 37.3 Å2.