2,3,5-Trifluorobromobenzene

• CAS: 133739-70-5
• Catalog Number: ACM133739705
• Category: Bromine Series
• Molecular Weight: 210.98
• Molecular Formula: C₆F₆
• Hazard Statements: H226-H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS02

Custom Q&A

What is the molecular formula of 2,3,5-Trifluorobromobenzene?

The molecular formula of 2,3,5-Trifluorobromobenzene is C6H2BrF3.

What is the molecular weight of 2,3,5-Trifluorobromobenzene?

The molecular weight of 2,3,5-Trifluorobromobenzene is 210.98 g/mol.

What is the IUPAC name of 2,3,5-Trifluorobromobenzene?

The IUPAC name of 2,3,5-Trifluorobromobenzene is 1-bromo-2,3,5-trifluorobenzene.

What is the InChI of 2,3,5-Trifluorobromobenzene?

The InChI of 2,3,5-Trifluorobromobenzene is InChI=1S/C6H2BrF3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H.

What is the InChIKey of 2,3,5-Trifluorobromobenzene?

The InChIKey of 2,3,5-Trifluorobromobenzene is XSMLLZPSNLQCQU-UHFFFAOYSA-N.

How many hydrogen bond acceptor counts does 2,3,5-Trifluorobromobenzene have?

2,3,5-Trifluorobromobenzene has 3 hydrogen bond acceptor counts.

What is the exact mass of 2,3,5-Trifluorobromobenzene?

The exact mass of 2,3,5-Trifluorobromobenzene is 209.92920 g/mol.

What is the topological polar surface area of 2,3,5-Trifluorobromobenzene?

The topological polar surface area of 2,3,5-Trifluorobromobenzene is 0Ų.

Does 2,3,5-Trifluorobromobenzene have any defined atom stereocenter count?

No, 2,3,5-Trifluorobromobenzene does not have any defined atom stereocenter count.

Is 2,3,5-Trifluorobromobenzene considered a canonicalized compound?

Yes, 2,3,5-Trifluorobromobenzene is considered a canonicalized compound.