2,2-Thiobis(4-methylphenol)

• CAS: 2929-96-6
• Catalog Number: ACM2929966
• Category: Other Products
• Molecular Weight: 246.32476
• Molecular Formula: C₁₄H₁₄O₂S
• Synonyms: 2,2-Thiobis(4-Methylphenol);2,2-Bis(p-cresol) sulfide;2,2-Thiobis[p-cresol];2,2-Thiodi-p-cresol

Custom Q&A

What is the molecular formula of 2,2-Thiobis(4-methylphenol)?

The molecular formula of 2,2-Thiobis(4-methylphenol) is C14H14O2S.

What is the molecular weight of 2,2-Thiobis(4-methylphenol)?

The molecular weight of 2,2-Thiobis(4-methylphenol) is 246.33 g/mol.

What is the IUPAC name of 2,2-Thiobis(4-methylphenol)?

The IUPAC name of 2,2-Thiobis(4-methylphenol) is 2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylphenol.

What is the InChI of 2,2-Thiobis(4-methylphenol)?

The InChI of 2,2-Thiobis(4-methylphenol) is InChI=1S/C14H14O2S/c1-9-3-5-11(15)13(7-9)17-14-8-10(2)4-6-12(14)16/h3-8,15-16H,1-2H3.

What is the InChIKey of 2,2-Thiobis(4-methylphenol)?

The InChIKey of 2,2-Thiobis(4-methylphenol) is CHNWLKJYOVQXOG-UHFFFAOYSA-N.

What is the canonical SMILES of 2,2-Thiobis(4-methylphenol)?

The canonical SMILES of 2,2-Thiobis(4-methylphenol) is CC1=CC(=C(C=C1)O)SC2=C(C=CC(=C2)C)O.

What is the ChEMBL ID of 2,2-Thiobis(4-methylphenol)?

The ChEMBL ID of 2,2-Thiobis(4-methylphenol) is CHEMBL1336664.

What is the XLogP3-AA of 2,2-Thiobis(4-methylphenol)?

The XLogP3-AA of 2,2-Thiobis(4-methylphenol) is 4.

How many hydrogen bond donor count does 2,2-Thiobis(4-methylphenol) have?

2,2-Thiobis(4-methylphenol) has 2 hydrogen bond donor counts.