[2-(2-Methoxyethoxy)phenyl]methanamine

• Catalog Number: ACMA00001991
• Category: Ethers
• Molecular Weight: 181.23
• Molecular Formula: C₁₀H₁₅NO
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of [2-(2-Methoxyethoxy)phenyl]methanamine?

The molecular formula is C10H15NO2.

What is the molecular weight of [2-(2-Methoxyethoxy)phenyl]methanamine?

The molecular weight is 181.23 g/mol.

What is the IUPAC name of [2-(2-Methoxyethoxy)phenyl]methanamine?

The IUPAC name is [2-(2-methoxyethoxy)phenyl]methanamine.

What is the InChI of [2-(2-Methoxyethoxy)phenyl]methanamine?

The InChI is InChI=1S/C10H15NO2/c1-12-6-7-13-10-5-3-2-4-9(10)8-11/h2-5H,6-8,11H2,1H3.

What is the InChIKey of [2-(2-Methoxyethoxy)phenyl]methanamine?

The InChIKey is MQPPRLDARZKFDV-UHFFFAOYSA-N.

What is the canonical SMILES of [2-(2-Methoxyethoxy)phenyl]methanamine?

The canonical SMILES is COCCOC1=CC=CC=C1CN.

What is the XLogP3-AA value of [2-(2-Methoxyethoxy)phenyl]methanamine?

The XLogP3-AA value is 0.6.

How many hydrogen bond donor counts does [2-(2-Methoxyethoxy)phenyl]methanamine have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does [2-(2-Methoxyethoxy)phenyl]methanamine have?

It has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does [2-(2-Methoxyethoxy)phenyl]methanamine have?

It has 5 rotatable bond counts.