2-(2-Fluoro-benzylamino)-butan-1-ol

• Catalog Number: ACMA00000934
• Category: Amines
• Molecular Weight: 197.25
• Molecular Formula: C₁₁H₁₅N₃
• Hazard Statements: H302-H317-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-(2-Fluoro-benzylamino)-butan-1-ol?

The molecular formula is C11H16FNO.

What is the molecular weight of 2-(2-Fluoro-benzylamino)-butan-1-ol?

The molecular weight is 197.25 g/mol.

What is the IUPAC name of 2-(2-Fluoro-benzylamino)-butan-1-ol?

The IUPAC name is 2-[(2-fluorophenyl)methylamino]butan-1-ol.

What is the InChI of 2-(2-Fluoro-benzylamino)-butan-1-ol?

The InChI is InChI=1S/C11H16FNO/c1-2-10(8-14)13-7-9-5-3-4-6-11(9)12/h3-6,10,13-14H,2,7-8H2,1H3.

What is the InChIKey of 2-(2-Fluoro-benzylamino)-butan-1-ol?

The InChIKey is WDLIUSVZZOVBQW-UHFFFAOYSA-N.

How many hydrogen bond donor counts are there in 2-(2-Fluoro-benzylamino)-butan-1-ol?

There are 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts are there in 2-(2-Fluoro-benzylamino)-butan-1-ol?

There are 3 hydrogen bond acceptor counts.

What is the topological polar surface area of 2-(2-Fluoro-benzylamino)-butan-1-ol?

The topological polar surface area is 32.3Ų.

Is 2-(2-Fluoro-benzylamino)-butan-1-ol a canonicalized compound?

Yes, it is a canonicalized compound.

How many rotatable bond counts are there in 2-(2-Fluoro-benzylamino)-butan-1-ol?

There are 5 rotatable bond counts.