CAS
943-14-6 Purity
---
943-14-6 Purity
---
Inquiry Basket
2-(2-Bromophenyl)ethanol
CAS
1074-16-4
Catalog Number
ACM1074164
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(2-bromophenyl)ethanol.
What is the molecular formula of the compound?
The molecular formula of the compound is C8H9BrO.
What is the molecular weight of the compound?
The molecular weight of the compound is 201.06 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H9BrO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2.
What is the CAS number of the compound?
The CAS number of the compound is 1074-16-4.
How many hydrogen bond donor atoms are present in the compound?
There is 1 hydrogen bond donor atom in the compound.
How many hydrogen bond acceptor atoms are present in the compound?
There is 1 hydrogen bond acceptor atom in the compound.
How many rotatable bonds are present in the compound?
There are 2 rotatable bonds in the compound.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 20.2Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![6-Bromo-3-methylbenzo[d]isoxazole](https://resource.alfa-chemistry.com/structure/66033-69-0.gif)
![8-Bromo-2-(methylthio)pyrazolo[1,5-a][1,3,5]triazin-4-ol](https://resource.alfa-chemistry.com/structure/54346-35-9.gif)
CAS
54346-35-9 Purity
---
54346-35-9 Purity
---
