(-)-(1R,3S)-3-Aminocyclopentanecarboxylic acid

• Catalog Number: ACMA00001377
• Category: Amines
• Molecular Weight: 129.16
• Molecular Formula: C₆H₁₀N₂S
• Hazard Statements: H301
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is (1R,3S)-3-aminocyclopentane-1-carboxylic acid.

What is the molecular weight of the compound?

The molecular weight of the compound is 129.16 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C6H11NO2/c7-5-2-1-4(3-5)6(8)9/h4-5H,1-3,7H2,(H,8,9)/t4-,5+/m1/s1.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1CC(CC1C(=O)O)N.

How many hydrogen bond donor counts does the compound have?

The compound has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is -2.6.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 63.3Ų.

How many defined atom stereocenter counts does the compound have?

The compound has 2 defined atom stereocenter counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.