16Alpha-fluoro-17beta-estradiol

CAS

92817-10-2

Catalog Number

ACM92817102

Category

Other Products

Molecular Weight

290.37

Molecular Formula

C₁₈H₂₃FO₂

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

16ALPHA-FLUORO-17BETA-ESTRADIOL;16ALPHA-FLUOROESTRADIOL;ESTRA-1,3,5(10)-TRIENE-3,17-DIOL, 16-FLUORO-, (16ALPHA, 17BETA);16a-Fluoro-13beta-methyl-1,3,5(10)-gonatriene-3,17betadiol;Estra-1,3,5(10)-triene-3,17-diol, 16-fluoro-, (16a,17beta);16a-Fluoro-17beta-estradiol;16a-Fluoroestradiol

What is the molecular formula of 16Alpha-fluoro-17beta-estradiol?

The molecular formula of 16Alpha-fluoro-17beta-estradiol is C18H23FO2.

What is the molecular weight of 16Alpha-fluoro-17beta-estradiol?

The molecular weight of 16Alpha-fluoro-17beta-estradiol is 290.4 g/mol.

What is the IUPAC name of 16Alpha-fluoro-17beta-estradiol?

The IUPAC name of 16Alpha-fluoro-17beta-estradiol is (8R,9S,13S,14S,16R,17R)-16-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.

What is the InChIKey of 16Alpha-fluoro-17beta-estradiol?

The InChIKey of 16Alpha-fluoro-17beta-estradiol is KDLLNMRYZGUVMA-ZXXIGWHRSA-N.

What is the Canonical SMILES of 16Alpha-fluoro-17beta-estradiol?

The Canonical SMILES of 16Alpha-fluoro-17beta-estradiol is CC12CCC3C(C1CC(C2O)F)CCC4=C3C=CC(=C4)O.

What is the molecular weight of 16Alpha-fluoro-17beta-estradiol computed by XLogP3?

The molecular weight of 16Alpha-fluoro-17beta-estradiol computed by XLogP3 is 3.5.

How many hydrogen bond donor counts are there in 16Alpha-fluoro-17beta-estradiol?

There are 2 hydrogen bond donor counts in 16Alpha-fluoro-17beta-estradiol.

What is the exact mass of 16Alpha-fluoro-17beta-estradiol?

The exact mass of 16Alpha-fluoro-17beta-estradiol is 290.16820813 g/mol.

What is the topological polar surface area of 16Alpha-fluoro-17beta-estradiol?

The topological polar surface area of 16Alpha-fluoro-17beta-estradiol is 40.5 Å².

How many defined atom stereocenter counts are there in 16Alpha-fluoro-17beta-estradiol?

There are 6 defined atom stereocenter counts in 16Alpha-fluoro-17beta-estradiol.