(1-[(Methylamino)methyl]cyclopropyl)methanol

• CAS: 959238-63-2
• Catalog Number: ACM959238632-1
• Category: Amines
• Molecular Weight: 115.17
• Molecular Formula: C₆H₁₃N
• Hazard Statements: H319
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C6H13NO.

What is the molecular weight of the compound?

The molecular weight of the compound is 115.17 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is [1-(methylaminomethyl)cyclopropyl]methanol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C6H13NO/c1-7-4-6(5-8)2-3-6/h7-8H,2-5H2,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is JDQZUWZHXPZFNU-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CNCC1(CC1)CO.

What is the CAS number of the compound?

The CAS number of the compound is 959238-63-2.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 865-913-6.

What is the ChEMBL ID of the compound?

The ChEMBL ID of the compound is CHEMBL4555450.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is -0.3.