1-Cyclopropyl-ethylamine

• Catalog Number: ACMA00001227
• Category: Amines
• Molecular Weight: 85.15
• Molecular Formula: C₅H₁₀N₂O
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1-cyclopropylethanamine.

What is the molecular formula of the compound?

The molecular formula of the compound is C5H11N.

What is the molecular weight of the compound?

The molecular weight of the compound is 85.15 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C5H11N/c1-4(6)5-2-3-5/h4-5H,2-3,6H2,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is IXCXVGWKYIDNOS-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC(C1CC1)N.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 0.5.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 1 hydrogen bond acceptor count.

How many rotatable bond counts does the compound have?

The compound has 1 rotatable bond count.