CAS
959741-34-5 Purity
96%
959741-34-5 Purity
96%
Inquiry Basket
1-Cyano-2-bromo-5-nitrobenzene
CAS
134604-07-2
Catalog Number
ACM134604072
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1-Cyano-2-bromo-5-nitrobenzene?
The molecular formula of 1-Cyano-2-bromo-5-nitrobenzene is C7H3BrN2O2.
What is the molecular weight of 1-Cyano-2-bromo-5-nitrobenzene?
The molecular weight of 1-Cyano-2-bromo-5-nitrobenzene is 227.01 g/mol.
What is the IUPAC name of 1-Cyano-2-bromo-5-nitrobenzene?
The IUPAC name of 1-Cyano-2-bromo-5-nitrobenzene is 2-bromo-5-nitrobenzonitrile.
What is the InChI of 1-Cyano-2-bromo-5-nitrobenzene?
The InChI of 1-Cyano-2-bromo-5-nitrobenzene is InChI=1S/C7H3BrN2O2/c8-7-2-1-6(10(11)12)3-5(7)4-9/h1-3H.
What is the InChIKey of 1-Cyano-2-bromo-5-nitrobenzene?
The InChIKey of 1-Cyano-2-bromo-5-nitrobenzene is RKODNVITKISFKU-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Cyano-2-bromo-5-nitrobenzene?
The canonical SMILES of 1-Cyano-2-bromo-5-nitrobenzene is C1=CC(=C(C=C1[N+](=O)[O-])C#N)Br.
What is the CAS number of 1-Cyano-2-bromo-5-nitrobenzene?
The CAS number of 1-Cyano-2-bromo-5-nitrobenzene is 134604-07-2.
What is the XLogP3-AA value of 1-Cyano-2-bromo-5-nitrobenzene?
The XLogP3-AA value of 1-Cyano-2-bromo-5-nitrobenzene is 2.2.
How many hydrogen bond acceptor count does 1-Cyano-2-bromo-5-nitrobenzene have?
1-Cyano-2-bromo-5-nitrobenzene has 3 hydrogen bond acceptor count.
What is the topological polar surface area of 1-Cyano-2-bromo-5-nitrobenzene?
The topological polar surface area of 1-Cyano-2-bromo-5-nitrobenzene is 69.6Ų.
Recommended Products
![3-Bromo-5-chloropyrazolo[1,5-a]pyrimidine](https://resource.alfa-chemistry.com/structure/960613-96-1.gif)
