1-Chloro-3,3,4,4,5,5-hexafluoro-2-methoxycyclopentene

• CAS: 336-34-5
• Catalog Number: ACM336345-1
• Category: Alkenyl
• Molecular Weight: 240.53
• Hazard Statements: H301
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1-chloro-3,3,4,4,5,5-hexafluoro-2-methoxycyclopentene.

What is the molecular formula of the compound?

The molecular formula of the compound is C6H3ClF6O.

What is the molecular weight of the compound?

The molecular weight of the compound is 240.53 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C6H3ClF6O/c1-14-3-2(7)4(8,9)6(12,13)5(3,10)11/h1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is QLPINEFCFXPUSF-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is COC1=C(C(C(C1(F)F)(F)F)(F)F)Cl.

What is the CAS number of the compound?

The CAS number of the compound is 336-34-5.

What is the EC number of the compound?

The EC number of the compound is 621-878-7.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 2.5.

Is the compound canonicalized?

Yes, the compound is canonicalized.