1-Bromo-3-methoxy-5-methylbenzene

• Catalog Number: ACMA00002733
• Category: Ethers
• Molecular Weight: 201.06
• Molecular Formula: C₈H₈O₄
• Hazard Statements: H302-H315-H319-H335
• RIDADR: UN 3334
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1-Bromo-3-methoxy-5-methylbenzene?

The molecular formula is C8H9BrO.

What is the molecular weight of 1-Bromo-3-methoxy-5-methylbenzene?

The molecular weight is 201.06 g/mol.

What is the IUPAC name of 1-Bromo-3-methoxy-5-methylbenzene?

The IUPAC name is 1-bromo-3-methoxy-5-methylbenzene.

What is the InChI of 1-Bromo-3-methoxy-5-methylbenzene?

The InChI is InChI=1S/C8H9BrO/c1-6-3-7(9)5-8(4-6)10-2/h3-5H,1-2H3.

What is the InChIKey of 1-Bromo-3-methoxy-5-methylbenzene?

The InChIKey is AOEVRCZZWJWKPG-UHFFFAOYSA-N.

What is the Canonical SMILES of 1-Bromo-3-methoxy-5-methylbenzene?

The Canonical SMILES is CC1=CC(=CC(=C1)Br)OC.

What is the CAS number of 1-Bromo-3-methoxy-5-methylbenzene?

The CAS number is 29578-83-4.

What is the XLogP3-AA value of 1-Bromo-3-methoxy-5-methylbenzene?

The XLogP3-AA value is 2.9.

How many hydrogen bond donor counts does 1-Bromo-3-methoxy-5-methylbenzene have?

1-Bromo-3-methoxy-5-methylbenzene has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 1-Bromo-3-methoxy-5-methylbenzene have?

1-Bromo-3-methoxy-5-methylbenzene has 1 hydrogen bond acceptor count.