34683-73-3 Purity
N/A
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C6H13Br.
The molecular weight is 165.07 g/mol.
Some synonyms include 3-(Bromomethyl)pentane, 2-Ethylbutyl bromide, and Pentane, 3-(bromomethyl)-.
The IUPAC name is 3-(bromomethyl)pentane.
The InChI is InChI=1S/C6H13Br/c1-3-6(4-2)5-7/h6H,3-5H2,1-2H3.
There are 0 hydrogen bond donor counts.
The XLogP3-AA value is 3.
There are 3 rotatable bond counts.
The topological polar surface area is 0Ų.
Yes, it is a canonicalized compound.