CAS
5324-13-0 Purity
97%
5324-13-0 Purity
97%
Inquiry Basket
1-Bromo-2-chloro-4-ethoxybenzene
CAS
313545-43-6
Catalog Number
ACM313545436
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1-Bromo-2-chloro-4-ethoxybenzene?
The molecular formula of 1-Bromo-2-chloro-4-ethoxybenzene is C8H8BrClO.
What is the molecular weight of 1-Bromo-2-chloro-4-ethoxybenzene?
The molecular weight of 1-Bromo-2-chloro-4-ethoxybenzene is 235.50 g/mol.
What is the IUPAC name of 1-Bromo-2-chloro-4-ethoxybenzene?
The IUPAC name of 1-Bromo-2-chloro-4-ethoxybenzene is 1-bromo-2-chloro-4-ethoxybenzene.
What is the InChI of 1-Bromo-2-chloro-4-ethoxybenzene?
The InChI of 1-Bromo-2-chloro-4-ethoxybenzene is InChI=1S/C8H8BrClO/c1-2-11-6-3-4-7(9)8(10)5-6/h3-5H,2H2,1H3.
What is the InChIKey of 1-Bromo-2-chloro-4-ethoxybenzene?
The InChIKey of 1-Bromo-2-chloro-4-ethoxybenzene is QOVFYQVZTTUBMW-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Bromo-2-chloro-4-ethoxybenzene?
The canonical SMILES of 1-Bromo-2-chloro-4-ethoxybenzene is CCOC1=CC(=C(C=C1)Br)Cl.
What is the CAS number of 1-Bromo-2-chloro-4-ethoxybenzene?
The CAS number of 1-Bromo-2-chloro-4-ethoxybenzene is 313545-43-6.
What is the XLogP3-AA value of 1-Bromo-2-chloro-4-ethoxybenzene?
The XLogP3-AA value of 1-Bromo-2-chloro-4-ethoxybenzene is 3.6.
How many hydrogen bond donor counts does 1-Bromo-2-chloro-4-ethoxybenzene have?
1-Bromo-2-chloro-4-ethoxybenzene has 0 hydrogen bond donor count.
How many rotatable bond counts does 1-Bromo-2-chloro-4-ethoxybenzene have?
1-Bromo-2-chloro-4-ethoxybenzene has 2 rotatable bond counts.
Recommended Products
