1-Benzothiophene-5-carboxylic acid

• CAS: 2060-64-2
• Catalog Number: ACM2060642
• Category: Other Products
• Molecular Weight: 178.21
• Molecular Formula: C₉H₆O₂S
• Synonyms: BUTTPARK 98\04-76;1-BENZOTHIOPHENE-5-CARBOXYLIC ACID;5-CARBOXYBENZO[B]THIOPHENE;5-BENZOTHIOPHENECARBOXALDEHYDE;Benzo[b]thiophene-5-carboxylic acid;Benzothiophene-5-carboxylic acid
• Hazard Statements: Xi
• Safety Description: 26

Custom Q&A

What is the molecular formula of 1-Benzothiophene-5-carboxylic acid?

The molecular formula of 1-Benzothiophene-5-carboxylic acid is C9H6O2S.

What is the molecular weight of 1-Benzothiophene-5-carboxylic acid?

The molecular weight of 1-Benzothiophene-5-carboxylic acid is 178.21 g/mol.

What is the IUPAC name of 1-Benzothiophene-5-carboxylic acid?

The IUPAC name of 1-Benzothiophene-5-carboxylic acid is 1-benzothiophene-5-carboxylic acid.

What is the InChI of 1-Benzothiophene-5-carboxylic acid?

The InChI of 1-Benzothiophene-5-carboxylic acid is InChI=1S/C9H6O2S/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H,(H,10,11).

How many hydrogen bond donor count does 1-Benzothiophene-5-carboxylic acid have?

1-Benzothiophene-5-carboxylic acid has 1 hydrogen bond donor count.

What is the exact mass of 1-Benzothiophene-5-carboxylic acid?

The exact mass of 1-Benzothiophene-5-carboxylic acid is 178.00885060 g/mol.

How many heavy atoms are there in 1-Benzothiophene-5-carboxylic acid?

There are 12 heavy atoms in 1-Benzothiophene-5-carboxylic acid.

What is the formal charge of 1-Benzothiophene-5-carboxylic acid?

The formal charge of 1-Benzothiophene-5-carboxylic acid is 0.

Is 1-Benzothiophene-5-carboxylic acid canonicalized?

Yes, 1-Benzothiophene-5-carboxylic acid is canonicalized.

What is the topological polar surface area of 1-Benzothiophene-5-carboxylic acid?

The topological polar surface area of 1-Benzothiophene-5-carboxylic acid is 65.5 Ų.