1-(4-Ethoxycarbonylphenyl)-2-thiourea

• Catalog Number: ACMA00002041
• Category: Ethers
• Molecular Weight: 224.28
• Molecular Formula: C₁₀H₁₁NO₄
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is ethyl 4-(carbamothioylamino)benzoate.

What is the molecular formula of the compound?

The molecular formula of the compound is C10H12N2O2S.

What is the molecular weight of the compound?

The molecular weight of the compound is 224.28 g/mol.

What is the InChI code of the compound?

The InChI code of the compound is InChI=1S/C10H12N2O2S/c1-2-14-9(13)7-3-5-8(6-4-7)12-10(11)15/h3-6H,2H2,1H3,(H3,11,12,15).

What is the InChIKey of the compound?

The InChIKey of the compound is ZJGHEUYKWKTKCH-UHFFFAOYSA-N.

What is the CAS number of the compound?

The CAS number of the compound is 23051-16-3.

What is the EC number of the compound?

The EC number of the compound is 674-205-4.

What is the XLogP3 value of the compound?

The XLogP3 value of the compound is 2.

How many hydrogen bond donor count does the compound have?

The compound has 2 hydrogen bond donor counts.

How many rotatable bond counts does the compound have?

The compound has 4 rotatable bond counts.