1,4-Dibromotetrafluorobenzene

• CAS: 344-03-6
• Catalog Number: ACM344036
• Category: Amino Alcohols
• Molecular Weight: 307.87
• Molecular Formula: C₆Br₂F₄
• Hazard Statements: H315-H319-H335
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1,4-Dibromotetrafluorobenzene?

The molecular formula of 1,4-Dibromotetrafluorobenzene is C6Br2F4.

What is the molecular weight of 1,4-Dibromotetrafluorobenzene?

The molecular weight of 1,4-Dibromotetrafluorobenzene is 307.87 g/mol.

What is the IUPAC name of 1,4-Dibromotetrafluorobenzene?

The IUPAC name of 1,4-Dibromotetrafluorobenzene is 1,4-dibromo-2,3,5,6-tetrafluorobenzene.

What is the InChI of 1,4-Dibromotetrafluorobenzene?

The InChI of 1,4-Dibromotetrafluorobenzene is InChI=1S/C6Br2F4/c7-1-3(9)5(11)2(8)6(12)4(1)10.

What is the InChIKey of 1,4-Dibromotetrafluorobenzene?

The InChIKey of 1,4-Dibromotetrafluorobenzene is QFTZULJNRAHOIY-UHFFFAOYSA-N.

What is the canonical SMILES of 1,4-Dibromotetrafluorobenzene?

The canonical SMILES of 1,4-Dibromotetrafluorobenzene is C1(=C(C(=C(C(=C1Br)F)F)Br)F)F.

What is the CAS number of 1,4-Dibromotetrafluorobenzene?

The CAS number of 1,4-Dibromotetrafluorobenzene is 344-03-6.

What is the UNII of 1,4-Dibromotetrafluorobenzene?

The UNII of 1,4-Dibromotetrafluorobenzene is HR9W6V9DNN.

What is the XLogP3-AA value of 1,4-Dibromotetrafluorobenzene?

The XLogP3-AA value of 1,4-Dibromotetrafluorobenzene is 3.7.

Is 1,4-Dibromotetrafluorobenzene a canonicalized compound?

Yes, 1,4-Dibromotetrafluorobenzene is a canonicalized compound.