1,4-Bis(trifluoromethyl)benzene

• CAS: 433-19-2
• Catalog Number: ACM433192
• Category: Aryl
• Molecular Weight: 214.11
• Hazard Statements: H314
• RIDADR: UN 1993BF 3 / PGII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 1,4-Bis(trifluoromethyl)benzene?

The molecular formula is C8H4F6.

What is the molecular weight of 1,4-Bis(trifluoromethyl)benzene?

The molecular weight is 214.11 g/mol.

What is the IUPAC name of 1,4-Bis(trifluoromethyl)benzene?

The IUPAC name is 1,4-bis(trifluoromethyl)benzene.

What is the InChI of 1,4-Bis(trifluoromethyl)benzene?

The InChI is InChI=1S/C8H4F6/c9-7(10,11)5-1-2-6(4-3-5)8(12,13)14/h1-4H.

What is the InChIKey of 1,4-Bis(trifluoromethyl)benzene?

The InChIKey is PDCBZHHORLHNCZ-UHFFFAOYSA-N.

What is the canonical SMILES of 1,4-Bis(trifluoromethyl)benzene?

The canonical SMILES is C1=CC(=CC=C1C(F)(F)F)C(F)(F)F.

What is the CAS number of 1,4-Bis(trifluoromethyl)benzene?

The CAS number is 433-19-2.

What is the EC number of 1,4-Bis(trifluoromethyl)benzene?

The EC number is 207-086-0.

What is the UNII of 1,4-Bis(trifluoromethyl)benzene?

The UNII is A7C3RX7Y2R.

Is 1,4-Bis(trifluoromethyl)benzene a covalently-bonded unit?

Yes, 1,4-Bis(trifluoromethyl)benzene is a covalently-bonded unit.