1-(3-Propoxyphenyl)ethanamine

• Catalog Number: ACMA00002119
• Category: Ethers
• Molecular Weight: 179.26
• Molecular Formula: C₁₁H₁₅N₃O₃S
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1-(3-propoxyphenyl)ethanamine?

The molecular formula is C11H17NO.

What is the molecular weight of 1-(3-propoxyphenyl)ethanamine?

The molecular weight is 179.26 g/mol.

What is the IUPAC name of 1-(3-propoxyphenyl)ethanamine?

The IUPAC name is 1-(3-propoxyphenyl)ethanamine.

What is the InChI of 1-(3-propoxyphenyl)ethanamine?

The InChI is InChI=1S/C11H17NO/c1-3-7-13-11-6-4-5-10(8-11)9(2)12/h4-6,8-9H,3,7,12H2,1-2H3.

What is the InChIKey of 1-(3-propoxyphenyl)ethanamine?

The InChIKey is GOORERYFOCDRFX-UHFFFAOYSA-N.

What is the canonical SMILES of 1-(3-propoxyphenyl)ethanamine?

The canonical SMILES is CCCOC1=CC=CC(=C1)C(C)N.

What is the CAS number of 1-(3-propoxyphenyl)ethanamine?

The CAS number is 925650-26-6.

What is the XLogP3-AA value of 1-(3-propoxyphenyl)ethanamine?

The XLogP3-AA value is 2.

How many hydrogen bond donor counts does 1-(3-propoxyphenyl)ethanamine have?

1-(3-propoxyphenyl)ethanamine has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 1-(3-propoxyphenyl)ethanamine have?

1-(3-propoxyphenyl)ethanamine has 2 hydrogen bond acceptor counts.