1-(3-Chlorophenyl)-2-(isopropylamino)ethanol

• Catalog Number: ACMA00000936
• Category: Amines
• Molecular Weight: 213.70
• Molecular Formula: C₁₁H₁₅NO₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound with PubChem CID 19913640?

The molecular formula is C11H16ClNO.

What are the synonyms of the compound?

The synonyms of the compound are 23299-18-5, 1-(3-CHLOROPHENYL)-2-(ISOPROPYLAMINO)ETHANOL, 1-(3-chlorophenyl)-2-(propan-2-ylamino)ethanol, and SCHEMBL9640610.

What is the computed IUPAC name of the compound?

The computed IUPAC name of the compound is 1-(3-chlorophenyl)-2-(propan-2-ylamino)ethanol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C11H16ClNO/c1-8(2)13-7-11(14)9-4-3-5-10(12)6-9/h3-6,8,11,13-14H,7H2,1-2H3.

What is the InChIKey of the compound?

The InChIKey of the compound is WPRYXHDMUFXECU-UHFFFAOYSA-N.

What is the canonical SMILES representation of the compound?

The canonical SMILES representation of the compound is CC(C)NCC(C1=CC(=CC=C1)Cl)O.

What is the molecular weight of the compound?

The molecular weight of the compound is 213.70 g/mol.

What is the XLogP3 value of the compound?

The XLogP3 value of the compound is 1.5.

How many hydrogen bond donor counts does the compound have?

The compound has 2 hydrogen bond donor counts.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 32.3Ų.