1,3-Bis(trifluoromethyl)benzene

• CAS: 402-31-3
• Catalog Number: ACM402313
• Category: Aryl
• Molecular Weight: 214.11
• Molecular Formula: C₆H₂Cl₄
• Hazard Statements: H314
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 1,3-Bis(trifluoromethyl)benzene?

The molecular formula is C8H4F6.

What is the molecular weight of 1,3-Bis(trifluoromethyl)benzene?

The molecular weight is 214.11 g/mol.

What is the IUPAC name of 1,3-Bis(trifluoromethyl)benzene?

The IUPAC name is 1,3-bis(trifluoromethyl)benzene.

What is the InChI of 1,3-Bis(trifluoromethyl)benzene?

The InChI is InChI=1S/C8H4F6/c9-7(10,11)5-2-1-3-6(4-5)8(12,13)14/h1-4H.

What is the InChIKey of 1,3-Bis(trifluoromethyl)benzene?

The InChIKey is SJBBXFLOLUTGCW-UHFFFAOYSA-N.

What is the canonical SMILES of 1,3-Bis(trifluoromethyl)benzene?

The canonical SMILES is C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F.

What is the CAS number of 1,3-Bis(trifluoromethyl)benzene?

The CAS number is 402-31-3.

What is the EC number of 1,3-Bis(trifluoromethyl)benzene?

The EC number is 206-939-4.

What is the UNII of 1,3-Bis(trifluoromethyl)benzene?

The UNII is F7TWF66P6X.

Is 1,3-Bis(trifluoromethyl)benzene a canonicalized compound?

Yes, 1,3-Bis(trifluoromethyl)benzene is a canonicalized compound.