What is the molecular formula of 1-(2-Methylphenyl)cyclopropanamine hydrochloride?
The molecular formula is C10H14ClN.
What is the molecular weight of 1-(2-Methylphenyl)cyclopropanamine hydrochloride?
The molecular weight is 183.68 g/mol.
What is the IUPAC name of 1-(2-Methylphenyl)cyclopropanamine hydrochloride?
The IUPAC name is 1-(2-methylphenyl)cyclopropan-1-amine;hydrochloride.
What is the InChI of 1-(2-Methylphenyl)cyclopropanamine hydrochloride?
The InChI is InChI=1S/C10H13N.ClH/c1-8-4-2-3-5-9(8)10(11)6-7-10;/h2-5H,6-7,11H2,1H3;1H.
What is the InChIKey of 1-(2-Methylphenyl)cyclopropanamine hydrochloride?
The InChIKey is ZTCSPKKBVQLMRB-UHFFFAOYSA-N.
What is the Canonical SMILES of 1-(2-Methylphenyl)cyclopropanamine hydrochloride?
The Canonical SMILES is CC1=CC=CC=C1C2(CC2)N.Cl.
What is the CAS number of 1-(2-Methylphenyl)cyclopropanamine hydrochloride?
The CAS number is 1134701-31-7.
What is the European Community (EC) number of 1-(2-Methylphenyl)cyclopropanamine hydrochloride?
The European Community (EC) number is 861-461-9.
What is the hydrogen bond donor count of 1-(2-Methylphenyl)cyclopropanamine hydrochloride?
The hydrogen bond donor count is 2.
Is 1-(2-Methylphenyl)cyclopropanamine hydrochloride a canonicalized compound?
Yes, 1-(2-Methylphenyl)cyclopropanamine hydrochloride is a canonicalized compound.