1-(2-Methyl-1,3-thiazol-4-yl)ethanamine dihydrochloride

• Catalog Number: ACMA00001369
• Category: Amines
• Molecular Weight: 215.14
• Molecular Formula: C₆H₁₁NO₃
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C6H12Cl2N2S.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1-(2-methyl-1,3-thiazol-4-yl)ethanamine;dihydrochloride.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C6H10N2S.2ClH/c1-4(7)6-3-9-5(2)8-6;;/h3-4H,7H2,1-2H3;2*1H.

What is the InChIKey of the compound?

The InChIKey of the compound is NSIYHWIWQYUIEN-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is CC1=NC(=CS1)C(C)N.Cl.Cl.

What is the molecular weight of the compound?

The molecular weight of the compound is 215.14 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 1 rotatable bond count.

What is the exact mass of the compound?

The exact mass of the compound is 214.0098250 g/mol.