1-(2-Methoxyphenyl)-1H-pyrazole

• CAS: 102908-37-2
• Catalog Number: ACM102908372
• Category: Other Products
• Molecular Weight: 174.1992
• Molecular Formula: C₁₀H₁₀N₂O
• Synonyms: 1-(2-Methoxyphenyl)-1H-pyrazole

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C10H10N2O.

What are some synonyms for the compound?

Some synonyms for the compound are 1-(2-methoxyphenyl)-1H-pyrazole and 1-(2-methoxyphenyl)pyrazole.

When was the compound created and last modified?

The compound was created on 2006-10-26 and last modified on 2023-12-30.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1-(2-methoxyphenyl)pyrazole.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C10H10N2O/c1-13-10-6-3-2-5-9(10)12-8-4-7-11-12/h2-8H,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is QQPGEFNKQAVDPB-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is COC1=CC=CC=C1N2C=CC=N2.

What is the molecular weight of the compound?

The molecular weight of the compound is 174.20 g/mol.

How many hydrogen bond acceptors does the compound have?

The compound has 2 hydrogen bond acceptors.

Is the compound canonicalized?

Yes, the compound is canonicalized.