1,2-Benzenediamine,4-chloro-5-(2,3-dichlorophenoxy)-

• CAS: 139369-42-9
• Catalog Number: ACM139369429
• Category: Other Products
• Molecular Weight: 303.57
• Molecular Formula: C₁₂H₉Cl₃N₂O
• Synonyms: 1,2-BENZENEDIAMINE, 4-CHLORO-5-(2,3-DICHLOROPHENOXY)-;4-CHLORO-5-(2,3-DICHLORO-PHENOXY)-1,2-BENZENEDIAMINE;4-Chloro-5-(2,3-dichlorophenoxy)benzene-1,2-diaMine

Custom Q&A

What is the molecular formula of 1,2-Benzenediamine,4-chloro-5-(2,3-dichlorophenoxy)-?

The molecular formula of 1,2-Benzenediamine,4-chloro-5-(2,3-dichlorophenoxy)- is C12H9Cl3N2O.

What is the molecular weight of 1,2-Benzenediamine,4-chloro-5-(2,3-dichlorophenoxy)-?

The molecular weight of 1,2-Benzenediamine,4-chloro-5-(2,3-dichlorophenoxy)- is 303.6 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-chloro-5-(2,3-dichlorophenoxy)benzene-1,2-diamine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C12H9Cl3N2O/c13-6-2-1-3-10(12(6)15)18-11-5-9(17)8(16)4-7(11)14/h1-5H,16-17H2.

What is the InChIKey of the compound?

The InChIKey of the compound is NNDWEKICDTYSCM-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1=CC(=C(C(=C1)Cl)Cl)OC2=C(C=C(C(=C2)N)N)Cl.

What is the CAS number of the compound?

The CAS number of the compound is 139369-42-9.

What is the molecular weight of the compound?

The molecular weight of the compound is 303.6 g/mol.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 4.

Is the compound canonicalized?

Yes, the compound is canonicalized.