1-(2,3-dihydrobenzofuran-5-yl)ethanone

• CAS: 90843-31-5
• Catalog Number: ACM90843315
• Category: Furans
• Molecular Weight: 162.19
• Molecular Formula: C10H10O2
• Synonyms: 5-Acetyl-2,3-dihydrobenzofuran
• Boiling Point: 308.6°C/760mmHg(lit.)
• Melting Point: 61-62°C(lit.)

Custom Q&A

What is the molecular formula of 1-(2,3-dihydrobenzofuran-5-yl)ethanone?

The molecular formula of 1-(2,3-dihydrobenzofuran-5-yl)ethanone is C10H10O2.

What is the molecular weight of 1-(2,3-dihydrobenzofuran-5-yl)ethanone?

The molecular weight of 1-(2,3-dihydrobenzofuran-5-yl)ethanone is 162.18 g/mol.

What is the IUPAC name of 1-(2,3-dihydrobenzofuran-5-yl)ethanone?

The IUPAC name of 1-(2,3-dihydrobenzofuran-5-yl)ethanone is 1-(2,3-dihydro-1-benzofuran-5-yl)ethanone.

What is the InChI code of 1-(2,3-dihydrobenzofuran-5-yl)ethanone?

The InChI code of 1-(2,3-dihydrobenzofuran-5-yl)ethanone is InChI=1S/C10H10O2/c1-7(11)8-2-3-10-9(6-8)4-5-12-10/h2-3,6H,4-5H2,1H3.

How many hydrogen bond donor counts does 1-(2,3-dihydrobenzofuran-5-yl)ethanone have?

1-(2,3-dihydrobenzofuran-5-yl)ethanone has 0 hydrogen bond donor counts.

What is the topological polar surface area of 1-(2,3-dihydrobenzofuran-5-yl)ethanone?

The topological polar surface area of 1-(2,3-dihydrobenzofuran-5-yl)ethanone is 26.3 Ų.

How many rotatable bond counts does 1-(2,3-dihydrobenzofuran-5-yl)ethanone have?

1-(2,3-dihydrobenzofuran-5-yl)ethanone has 1 rotatable bond count.

What is the XLogP3-AA value of 1-(2,3-dihydrobenzofuran-5-yl)ethanone?

The XLogP3-AA value of 1-(2,3-dihydrobenzofuran-5-yl)ethanone is 1.6.

Is 1-(2,3-dihydrobenzofuran-5-yl)ethanone considered a canonicalized compound?

Yes, 1-(2,3-dihydrobenzofuran-5-yl)ethanone is considered a canonicalized compound.

What is the PubChem CID of 1-(2,3-dihydrobenzofuran-5-yl)ethanone?

The PubChem CID of 1-(2,3-dihydrobenzofuran-5-yl)ethanone is 145220.