1,1,3,3,5-Pentamethylindan

• CAS: 81-03-8
• Catalog Number: ACM81038
• Category: Other Products
• Molecular Weight: 0
• Molecular Formula: C₁₄H₂₀
• Synonyms: 1,1,3,3,5-PENTAMETHYLINDANE;2,3-Dihydro-1,1,3,3,5-pentamethyl-1H-indene;1,1,3,3,5-pentamethyl-2H-indene

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1,1,3,3,5-pentamethyl-2H-indene.

What is the molecular formula of the compound?

The molecular formula of the compound is C14H20.

What is the molecular weight of the compound?

The molecular weight of the compound is 188.31 g/mol.

What is the InChI of the compound?

The InChI of the compound is "InChI=1S/C14H20/c1-10-6-7-11-12(8-10)14(4,5)9-13(11,2)3/h6-8H,9H2,1-5H3".

What is the InChIKey of the compound?

The InChIKey of the compound is "NNXHDILUOAXSPU-UHFFFAOYSA-N".

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is "CC1=CC2=C(C=C1)C(CC2(C)C)(C)C".

What is the CAS number of the compound?

The CAS number of the compound is 81-03-8.

What is the EC number of the compound?

The EC number of the compound is 201-316-3.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 4.9.

Is the compound canonicalized?

Yes, the compound is canonicalized.